C26H39NO4 — CID 11774728
tert-butyl (2S,6S)-2-[(1E,3Z,5S)-5-[(E)-3-(cyclohexen-1-yl)prop-2-enoyl]oxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate (PubChem CID 11774728) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is tert-butyl (2S,6S)-2-[(1E,3Z,5S)-5-[(E)-3-(cyclohexen-1-yl)prop-2-enoyl]oxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,6S)-2-[(1E,3Z,5S)-5-[(E)-3-(cyclohexen-1-yl)prop-2-enoyl]oxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11774728 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | tert-butyl (2S,6S)-2-[(1E,3Z,5S)-5-[(E)-3-(cyclohexen-1-yl)prop-2-enoyl]oxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H](/C=C\C=C\[C@@H]1CCC[C@H](C)N1C(=O)OC(C)(C)C)OC(=O)/C=C/C1=CCCCC1 |
| InChI | InChI=1S/C26H39NO4/c1-20-12-11-17-23(27(20)25(29)31-26(3,4)5)16-10-9-13-21(2)30-24(28)19-18-22-14-7-6-8-15-22/h9-10,13-14,16,18-21,23H,6-8,11-12,15,17H2,1-5H3/b13-9-,16-10+,19-18+/t20-,21-,23+/m0/s1 |
| InChIKey | XPDIHTILKATSDC-DAQGIORDSA-N |
| XLogP | 6.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|