C30H41FO3 — CID 86597850
ethyl (2E,4E,6E)-7-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate (PubChem CID 86597850) has the molecular formula C30H41FO3 and a molecular weight of 468.65 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate |
|---|---|
| PubChem CID | 86597850 |
| Molecular Formula | C30H41FO3 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(8-tert-butyl-3-ethoxy-5,5-dimethyl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C(F)=C(/CC)c1cc2c(cc1OCC)C(C)(C)CC=C2C(C)(C)C |
| InChI | InChI=1S/C30H41FO3/c1-10-21(26(31)14-13-20(4)17-28(32)34-12-3)22-18-23-24(29(5,6)7)15-16-30(8,9)25(23)19-27(22)33-11-2/h13-15,17-19H,10-12,16H2,1-9H3/b14-13+,20-17+,26-21+ |
| InChIKey | ULJKAOAGXQNKJW-UOEANCJPSA-N |
| XLogP | 8.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|