C29H38BrFO3 — CID 86597862
ethyl (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate (PubChem CID 86597862) has the molecular formula C29H38BrFO3 and a molecular weight of 533.52 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate |
|---|---|
| PubChem CID | 86597862 |
| Molecular Formula | C29H38BrFO3 |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(4-bromo-3-ethoxy-5,5-dimethyl-8-propan-2-yl-6H-naphthalen-2-yl)-6-fluoro-3-methylnona-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C(F)=C(/CC)c1cc2c(c(Br)c1OCC)C(C)(C)CC=C2C(C)C |
| InChI | InChI=1S/C29H38BrFO3/c1-9-20(24(31)13-12-19(6)16-25(32)33-10-2)23-17-22-21(18(4)5)14-15-29(7,8)26(22)27(30)28(23)34-11-3/h12-14,16-18H,9-11,15H2,1-8H3/b13-12+,19-16+,24-20+ |
| InChIKey | LVIMYVVACPCMCX-IXWKVKQYSA-N |
| XLogP | 8.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|