C28H37FO4 — CID 86759709
ethyl (2E,4E,6E)-7-(2,2-dimethyl-4-propan-2-yl-7-propoxychromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate (PubChem CID 86759709) has the molecular formula C28H37FO4 and a molecular weight of 456.60 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(2,2-dimethyl-4-propan-2-yl-7-propoxychromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(2,2-dimethyl-4-propan-2-yl-7-propoxychromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 86759709 |
| Molecular Formula | C28H37FO4 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(2,2-dimethyl-4-propan-2-yl-7-propoxychromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate |
| SMILES | CCCOc1cc2c(cc1/C(C)=C(F)\C=C\C(C)=C\C(=O)OCC)C(C(C)C)=CC(C)(C)O2 |
| InChI | InChI=1S/C28H37FO4/c1-9-13-32-25-16-26-22(23(18(3)4)17-28(7,8)33-26)15-21(25)20(6)24(29)12-11-19(5)14-27(30)31-10-2/h11-12,14-18H,9-10,13H2,1-8H3/b12-11+,19-14+,24-20+ |
| InChIKey | QTYPKVXGINTMGO-BWHGWIQKSA-N |
| XLogP | 7.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|