C25H32O4 — CID 20779618
(2E,4E,6Z)-7-(7-methoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-3-methylnona-2,4,6-trienoic acid (PubChem CID 20779618) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (2E,4E,6Z)-7-(7-methoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-3-methylnona-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-(7-methoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-3-methylnona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 20779618 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2E,4E,6Z)-7-(7-methoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-3-methylnona-2,4,6-trienoic acid |
| SMILES | CC/C(=C/C=C/C(C)=C/C(=O)O)c1cc2c(cc1OC)OC(C)(C)C=C2C(C)C |
| InChI | InChI=1S/C25H32O4/c1-8-18(11-9-10-17(4)12-24(26)27)19-13-20-21(16(2)3)15-25(5,6)29-23(20)14-22(19)28-7/h9-16H,8H2,1-7H3,(H,26,27)/b10-9+,17-12+,18-11- |
| InChIKey | XHEFCHGOTNDLLK-IXGCMVFISA-N |
| XLogP | 6.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|