C14H16O4 — CID 73413850
5-(5-hydroxy-2-methoxyphenyl)hepta-2,4-dienoic acid (PubChem CID 73413850) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-(5-hydroxy-2-methoxyphenyl)hepta-2,4-dienoic acid.
| Compound Name | 5-(5-hydroxy-2-methoxyphenyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 73413850 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-(5-hydroxy-2-methoxyphenyl)hepta-2,4-dienoic acid |
| SMILES | CCC(=CC=CC(=O)O)c1cc(O)ccc1OC |
| InChI | InChI=1S/C14H16O4/c1-3-10(5-4-6-14(16)17)12-9-11(15)7-8-13(12)18-2/h4-9,15H,3H2,1-2H3,(H,16,17) |
| InChIKey | LTBZTHDNRMXXNT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|