acetic acid;7-methoxy-8-methylnaphthalen-2-ol

C14H16O4 — CID 71322908

IUPACacetic acid;7-methoxy-8-methylnaphthalen-2-ol
SMILESCC(=O)O.COc1ccc2ccc(O)cc2c1C
InChIInChI=1S/C12H12O2.C2H4O2/c1-8-11-7-10(13)5-3-9(11)4-6-12(8)14-2;1-2(3)4/h3-7,13H,1-2H3;1H3,(H,3,4)
InChIKeyFLRJXNZZCDJCKS-UHFFFAOYSA-N
MW248.28 g/mol
LogP2.95
Rot. Bonds1

About acetic acid;7-methoxy-8-methylnaphthalen-2-ol

acetic acid;7-methoxy-8-methylnaphthalen-2-ol (PubChem CID 71322908) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is acetic acid;7-methoxy-8-methylnaphthalen-2-ol.

Molecular Properties

Compound Nameacetic acid;7-methoxy-8-methylnaphthalen-2-ol
PubChem CID71322908
Molecular FormulaC14H16O4
Molecular Weight248.28 g/mol
Exact Mass248.10
IUPAC Nameacetic acid;7-methoxy-8-methylnaphthalen-2-ol
SMILESCC(=O)O.COc1ccc2ccc(O)cc2c1C
InChIInChI=1S/C12H12O2.C2H4O2/c1-8-11-7-10(13)5-3-9(11)4-6-12(8)14-2;1-2(3)4/h3-7,13H,1-2H3;1H3,(H,3,4)
InChIKeyFLRJXNZZCDJCKS-UHFFFAOYSA-N
XLogP2.95
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.28
LogP ≤ 52.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;7-methoxy-8-methylnaphthalen-2-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;7-methoxy-8-methylnaphthalen-2-ol?
The IUPAC name of acetic acid;7-methoxy-8-methylnaphthalen-2-ol (CID 71322908) is acetic acid;7-methoxy-8-methylnaphthalen-2-ol.
What is the SMILES notation for acetic acid;7-methoxy-8-methylnaphthalen-2-ol?
The canonical SMILES for acetic acid;7-methoxy-8-methylnaphthalen-2-ol is CC(=O)O.COc1ccc2ccc(O)cc2c1C.
What is the InChIKey of acetic acid;7-methoxy-8-methylnaphthalen-2-ol?
The InChIKey is FLRJXNZZCDJCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2.C2H4O2/c1-8-11-7-10(13)5-3-9(11)4-6-12(8)14-2;1-2(3)4/h3-7,13H,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;7-methoxy-8-methylnaphthalen-2-ol?
acetic acid;7-methoxy-8-methylnaphthalen-2-ol has a molecular weight of 248.28 g/mol, XLogP of 2.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;7-methoxy-8-methylnaphthalen-2-ol is sourced from PubChem (CID 71322908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).