C24H24FO4- — CID 22491005
(E)-3-(2,2-dimethyl-4-phenyl-7-propoxychromen-6-yl)-2-fluorobut-2-enoate (PubChem CID 22491005) has the molecular formula C24H24FO4- and a molecular weight of 395.45 g/mol. Its IUPAC name is (E)-3-(2,2-dimethyl-4-phenyl-7-propoxychromen-6-yl)-2-fluorobut-2-enoate.
| Compound Name | (E)-3-(2,2-dimethyl-4-phenyl-7-propoxychromen-6-yl)-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 22491005 |
| Molecular Formula | C24H24FO4- |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (E)-3-(2,2-dimethyl-4-phenyl-7-propoxychromen-6-yl)-2-fluorobut-2-enoate |
| SMILES | CCCOc1cc2c(cc1/C(C)=C(/F)C(=O)[O-])C(c1ccccc1)=CC(C)(C)O2 |
| InChI | InChI=1S/C24H25FO4/c1-5-11-28-20-13-21-18(12-17(20)15(2)22(25)23(26)27)19(14-24(3,4)29-21)16-9-7-6-8-10-16/h6-10,12-14H,5,11H2,1-4H3,(H,26,27)/p-1/b22-15+ |
| InChIKey | OPUTXSRYQHPSTR-PXLXIMEGSA-M |
| XLogP | 4.53 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|