C16H18O5 — CID 43477195
2-methyl-5-[(2-propoxyphenoxy)methyl]furan-3-carboxylic acid (PubChem CID 43477195) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-methyl-5-[(2-propoxyphenoxy)methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(2-propoxyphenoxy)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43477195 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-methyl-5-[(2-propoxyphenoxy)methyl]furan-3-carboxylic acid |
| SMILES | CCCOc1ccccc1OCc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C16H18O5/c1-3-8-19-14-6-4-5-7-15(14)20-10-12-9-13(16(17)18)11(2)21-12/h4-7,9H,3,8,10H2,1-2H3,(H,17,18) |
| InChIKey | DICXXIOMKGOWGF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |