C13H13IN2O3 — CID 63569641
5-[(2-iodophenoxy)methyl]-2-methylfuran-3-carbohydrazide (PubChem CID 63569641) has the molecular formula C13H13IN2O3 and a molecular weight of 372.16 g/mol. Its IUPAC name is 5-[(2-iodophenoxy)methyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | 5-[(2-iodophenoxy)methyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 63569641 |
| Molecular Formula | C13H13IN2O3 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-[(2-iodophenoxy)methyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1oc(COc2ccccc2I)cc1C(=O)NN |
| InChI | InChI=1S/C13H13IN2O3/c1-8-10(13(17)16-15)6-9(19-8)7-18-12-5-3-2-4-11(12)14/h2-6H,7,15H2,1H3,(H,16,17) |
| InChIKey | CWILNJSLHXGKEO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|