C14H13BrO4 — CID 82828344
5-[(2-bromophenyl)methoxymethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 82828344) has the molecular formula C14H13BrO4 and a molecular weight of 325.16 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methoxymethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(2-bromophenyl)methoxymethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 82828344 |
| Molecular Formula | C14H13BrO4 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-[(2-bromophenyl)methoxymethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(COCc2ccccc2Br)cc1C(=O)O |
| InChI | InChI=1S/C14H13BrO4/c1-9-12(14(16)17)6-11(19-9)8-18-7-10-4-2-3-5-13(10)15/h2-6H,7-8H2,1H3,(H,16,17) |
| InChIKey | JIWOOWAUMGMBDD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |