C22H29FO4 — CID 86597829
ethyl (E)-3-(4-tert-butyl-7-methoxy-2,2-dimethylchromen-6-yl)-2-fluorobut-2-enoate (PubChem CID 86597829) has the molecular formula C22H29FO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is ethyl (E)-3-(4-tert-butyl-7-methoxy-2,2-dimethylchromen-6-yl)-2-fluorobut-2-enoate.
| Compound Name | ethyl (E)-3-(4-tert-butyl-7-methoxy-2,2-dimethylchromen-6-yl)-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 86597829 |
| Molecular Formula | C22H29FO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl (E)-3-(4-tert-butyl-7-methoxy-2,2-dimethylchromen-6-yl)-2-fluorobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(/C)c1cc2c(cc1OC)OC(C)(C)C=C2C(C)(C)C |
| InChI | InChI=1S/C22H29FO4/c1-9-26-20(24)19(23)13(2)14-10-15-16(21(3,4)5)12-22(6,7)27-18(15)11-17(14)25-8/h10-12H,9H2,1-8H3/b19-13+ |
| InChIKey | CFYDXSVQFILBCL-CPNJWEJPSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|