C14H16F2O5 — CID 117486921
ethyl 2-[3-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]-2-oxoacetate (PubChem CID 117486921) has the molecular formula C14H16F2O5 and a molecular weight of 302.27 g/mol. Its IUPAC name is ethyl 2-[3-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[3-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 117486921 |
| Molecular Formula | C14H16F2O5 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | ethyl 2-[3-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(OC)c(OC)c(C(C)(F)F)c1 |
| InChI | InChI=1S/C14H16F2O5/c1-5-21-13(18)11(17)8-6-9(14(2,15)16)12(20-4)10(7-8)19-3/h6-7H,5H2,1-4H3 |
| InChIKey | ZYDOEJQGXCBEBS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|