C29H37NO6 — CID 170557441
ethyl 2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 170557441) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is ethyl 2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 170557441 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | ethyl 2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(c1cc(OC)c(OC)c(OC)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37NO6/c1-11-36-27(32)19(16-30)24(18-14-22(33-8)26(35-10)23(15-18)34-9)17-12-20(28(2,3)4)25(31)21(13-17)29(5,6)7/h12-15,31H,11H2,1-10H3 |
| InChIKey | BXSLWSGQKKQAEC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|