C20H28O3 — CID 22490969
1-(7-butoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)ethanone (PubChem CID 22490969) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-(7-butoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)ethanone.
| Compound Name | 1-(7-butoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)ethanone |
|---|---|
| PubChem CID | 22490969 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-(7-butoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)ethanone |
| SMILES | CCCCOc1cc2c(cc1C(C)=O)C(C(C)C)=CC(C)(C)O2 |
| InChI | InChI=1S/C20H28O3/c1-7-8-9-22-18-11-19-16(10-15(18)14(4)21)17(13(2)3)12-20(5,6)23-19/h10-13H,7-9H2,1-6H3 |
| InChIKey | TZVRUIZAKRPXGO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|