C28H35ClO6 — CID 10345960
(2R)-2-[4-[3-(6-chloro-2,2-dimethyl-4-propan-2-ylchromen-7-yl)oxypropoxy]phenoxy]-2-methylbutanoic acid (PubChem CID 10345960) has the molecular formula C28H35ClO6 and a molecular weight of 503.04 g/mol. Its IUPAC name is (2R)-2-[4-[3-(6-chloro-2,2-dimethyl-4-propan-2-ylchromen-7-yl)oxypropoxy]phenoxy]-2-methylbutanoic acid.
| Compound Name | (2R)-2-[4-[3-(6-chloro-2,2-dimethyl-4-propan-2-ylchromen-7-yl)oxypropoxy]phenoxy]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 10345960 |
| Molecular Formula | C28H35ClO6 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (2R)-2-[4-[3-(6-chloro-2,2-dimethyl-4-propan-2-ylchromen-7-yl)oxypropoxy]phenoxy]-2-methylbutanoic acid |
| SMILES | CC[C@@](C)(Oc1ccc(OCCCOc2cc3c(cc2Cl)C(C(C)C)=CC(C)(C)O3)cc1)C(=O)O |
| InChI | InChI=1S/C28H35ClO6/c1-7-28(6,26(30)31)34-20-11-9-19(10-12-20)32-13-8-14-33-25-16-24-21(15-23(25)29)22(18(2)3)17-27(4,5)35-24/h9-12,15-18H,7-8,13-14H2,1-6H3,(H,30,31)/t28-/m1/s1 |
| InChIKey | GQNNUKCONOVZTK-MUUNZHRXSA-N |
| XLogP | 7.03 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|