C22H22ClF3O6 — CID 10005136
(2S)-5-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-propan-2-yl-3H-1-benzofuran-2-carboxylic acid (PubChem CID 10005136) has the molecular formula C22H22ClF3O6 and a molecular weight of 474.86 g/mol. Its IUPAC name is (2S)-5-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-propan-2-yl-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | (2S)-5-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-propan-2-yl-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 10005136 |
| Molecular Formula | C22H22ClF3O6 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (2S)-5-[3-[2-chloro-4-(trifluoromethoxy)phenoxy]propoxy]-2-propan-2-yl-3H-1-benzofuran-2-carboxylic acid |
| SMILES | CC(C)[C@]1(C(=O)O)Cc2cc(OCCCOc3ccc(OC(F)(F)F)cc3Cl)ccc2O1 |
| InChI | InChI=1S/C22H22ClF3O6/c1-13(2)21(20(27)28)12-14-10-15(4-6-18(14)32-21)29-8-3-9-30-19-7-5-16(11-17(19)23)31-22(24,25)26/h4-7,10-11,13H,3,8-9,12H2,1-2H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | WGTAXHBXOPSDFG-NRFANRHFSA-N |
| XLogP | 5.50 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|