C22H22ClF3O7 — CID 69302740
[(2R)-2-tert-butyl-5-[2-[2-chloro-4-(trifluoromethoxy)phenoxy]ethoxy]-3H-1-benzofuran-2-yl] hydrogen carbonate (PubChem CID 69302740) has the molecular formula C22H22ClF3O7 and a molecular weight of 490.86 g/mol. Its IUPAC name is [(2R)-2-tert-butyl-5-[2-[2-chloro-4-(trifluoromethoxy)phenoxy]ethoxy]-3H-1-benzofuran-2-yl] hydrogen carbonate.
| Compound Name | [(2R)-2-tert-butyl-5-[2-[2-chloro-4-(trifluoromethoxy)phenoxy]ethoxy]-3H-1-benzofuran-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69302740 |
| Molecular Formula | C22H22ClF3O7 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [(2R)-2-tert-butyl-5-[2-[2-chloro-4-(trifluoromethoxy)phenoxy]ethoxy]-3H-1-benzofuran-2-yl] hydrogen carbonate |
| SMILES | CC(C)(C)[C@]1(OC(=O)O)Cc2cc(OCCOc3ccc(OC(F)(F)F)cc3Cl)ccc2O1 |
| InChI | InChI=1S/C22H22ClF3O7/c1-20(2,3)21(33-19(27)28)12-13-10-14(4-6-17(13)32-21)29-8-9-30-18-7-5-15(11-16(18)23)31-22(24,25)26/h4-7,10-11H,8-9,12H2,1-3H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | PWNYKSOYKUSCKC-OAQYLSRUSA-N |
| XLogP | 6.07 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|