C28H38O5 — CID 10049635
5-[3-[4-(2,2-dimethylpropyl)-2-propylphenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid (PubChem CID 10049635) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 5-[3-[4-(2,2-dimethylpropyl)-2-propylphenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[3-[4-(2,2-dimethylpropyl)-2-propylphenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 10049635 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 5-[3-[4-(2,2-dimethylpropyl)-2-propylphenoxy]propoxy]-2-ethyl-3H-1-benzofuran-2-carboxylic acid |
| SMILES | CCCc1cc(CC(C)(C)C)ccc1OCCCOc1ccc2c(c1)CC(CC)(C(=O)O)O2 |
| InChI | InChI=1S/C28H38O5/c1-6-9-21-16-20(18-27(3,4)5)10-12-24(21)32-15-8-14-31-23-11-13-25-22(17-23)19-28(7-2,33-25)26(29)30/h10-13,16-17H,6-9,14-15,18-19H2,1-5H3,(H,29,30) |
| InChIKey | UGDBCWMWCMYMBN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|