C19H33NO — CID 14251086
3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propan-1-amine (PubChem CID 14251086) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propan-1-amine.
| Compound Name | 3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 14251086 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propan-1-amine |
| SMILES | CC(C)(C)Cc1ccc(OCCCN)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO/c1-18(2,3)13-15-8-9-17(21-11-7-10-20)16(12-15)14-19(4,5)6/h8-9,12H,7,10-11,13-14,20H2,1-6H3 |
| InChIKey | YTSCLCAEJUSPTI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|