C30H42N2O5S — CID 11555700
ethyl 2-[2-[3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate (PubChem CID 11555700) has the molecular formula C30H42N2O5S and a molecular weight of 542.74 g/mol. Its IUPAC name is ethyl 2-[2-[3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate.
| Compound Name | ethyl 2-[2-[3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
|---|---|
| PubChem CID | 11555700 |
| Molecular Formula | C30H42N2O5S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | ethyl 2-[2-[3-[2,4-bis(2,2-dimethylpropyl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
| SMILES | CCOC(=O)CC1=Nc2ccccc2S(=O)(=O)N1CCCOc1ccc(CC(C)(C)C)cc1CC(C)(C)C |
| InChI | InChI=1S/C30H42N2O5S/c1-8-36-28(33)19-27-31-24-12-9-10-13-26(24)38(34,35)32(27)16-11-17-37-25-15-14-22(20-29(2,3)4)18-23(25)21-30(5,6)7/h9-10,12-15,18H,8,11,16-17,19-21H2,1-7H3 |
| InChIKey | AETLDBUZUQJARH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|