C34H37N5O7S — CID 20722316
2-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-3,5-dimethylpyrazol-4-yl]acetic acid (PubChem CID 20722316) has the molecular formula C34H37N5O7S and a molecular weight of 659.77 g/mol. Its IUPAC name is 2-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-3,5-dimethylpyrazol-4-yl]acetic acid.
| Compound Name | 2-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-3,5-dimethylpyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20722316 |
| Molecular Formula | C34H37N5O7S |
| Molecular Weight | 659.77 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | 2-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-3,5-dimethylpyrazol-4-yl]acetic acid |
| SMILES | COc1ccccc1NC(=O)C(C1=Nc2ccccc2S(=O)(=O)N1CCCOc1ccc(C)cc1C)n1nc(C)c(CC(=O)O)c1C |
| InChI | InChI=1S/C34H37N5O7S/c1-21-15-16-28(22(2)19-21)46-18-10-17-38-33(35-27-12-7-9-14-30(27)47(38,43)44)32(34(42)36-26-11-6-8-13-29(26)45-5)39-24(4)25(20-31(40)41)23(3)37-39/h6-9,11-16,19,32H,10,17-18,20H2,1-5H3,(H,36,42)(H,40,41) |
| InChIKey | SPLPYVAONBDRMZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|