C29H32BrN3O5S — CID 20778535
2-bromo-2-[2-[3-(2,4-diethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 20778535) has the molecular formula C29H32BrN3O5S and a molecular weight of 614.56 g/mol. Its IUPAC name is 2-bromo-2-[2-[3-(2,4-diethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-bromo-2-[2-[3-(2,4-diethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 20778535 |
| Molecular Formula | C29H32BrN3O5S |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 2-bromo-2-[2-[3-(2,4-diethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCc1ccc(OCCCN2C(C(Br)C(=O)Nc3ccccc3OC)=Nc3ccccc3S2(=O)=O)c(CC)c1 |
| InChI | InChI=1S/C29H32BrN3O5S/c1-4-20-15-16-24(21(5-2)19-20)38-18-10-17-33-28(31-23-12-7-9-14-26(23)39(33,35)36)27(30)29(34)32-22-11-6-8-13-25(22)37-3/h6-9,11-16,19,27H,4-5,10,17-18H2,1-3H3,(H,32,34) |
| InChIKey | ZFDWSYUQBFBUHZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|