C25H26N4O9S — CID 71213247
methyl 2-[3-[1-(5-ethyl-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-(2-methoxyanilino)-2-oxoethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-yl]acetate (PubChem CID 71213247) has the molecular formula C25H26N4O9S and a molecular weight of 558.57 g/mol. Its IUPAC name is methyl 2-[3-[1-(5-ethyl-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-(2-methoxyanilino)-2-oxoethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-yl]acetate.
| Compound Name | methyl 2-[3-[1-(5-ethyl-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-(2-methoxyanilino)-2-oxoethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-yl]acetate |
|---|---|
| PubChem CID | 71213247 |
| Molecular Formula | C25H26N4O9S |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | methyl 2-[3-[1-(5-ethyl-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-(2-methoxyanilino)-2-oxoethyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-2-yl]acetate |
| SMILES | CCC1(C)OC(=O)N(C(C(=O)Nc2ccccc2OC)C2=Nc3ccccc3S(=O)(=O)N2CC(=O)OC)C1=O |
| InChI | InChI=1S/C25H26N4O9S/c1-5-25(2)23(32)29(24(33)38-25)20(22(31)27-15-10-6-8-12-17(15)36-3)21-26-16-11-7-9-13-18(16)39(34,35)28(21)14-19(30)37-4/h6-13,20H,5,14H2,1-4H3,(H,27,31) |
| InChIKey | FHSNFSZIQHVPCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |