C39H56N4O7S2 — CID 58720603
2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,4,4,6,6-pentamethylheptan-2-ylsulfanyl)phenyl]acetamide (PubChem CID 58720603) has the molecular formula C39H56N4O7S2 and a molecular weight of 757.03 g/mol. Its IUPAC name is 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,4,4,6,6-pentamethylheptan-2-ylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,4,4,6,6-pentamethylheptan-2-ylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 58720603 |
| Molecular Formula | C39H56N4O7S2 |
| Molecular Weight | 757.03 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-(2,4,4,6,6-pentamethylheptan-2-ylsulfanyl)phenyl]acetamide |
| SMILES | CCCCOCCCN1C(C(C(=O)Nc2ccccc2SC(C)(C)CC(C)(C)CC(C)(C)C)N2C(=O)OC(C)(C)C2=O)=Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C39H56N4O7S2/c1-11-12-23-49-24-17-22-42-32(40-28-19-14-16-21-30(28)52(42,47)48)31(43-34(45)39(9,10)50-35(43)46)33(44)41-27-18-13-15-20-29(27)51-38(7,8)26-37(5,6)25-36(2,3)4/h13-16,18-21,31H,11-12,17,22-26H2,1-10H3,(H,41,44) |
| InChIKey | SQXAWUHGMVBHBW-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.03 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|