C35H48N4O5S2 — CID 156895179
N-[5-tert-butyl-2-(2-ethylpentylsulfanyl)phenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-(3-methoxypropyl)-1,2,4-benzothiadiazin-3-yl]acetamide (PubChem CID 156895179) has the molecular formula C35H48N4O5S2 and a molecular weight of 668.93 g/mol. Its IUPAC name is N-[5-tert-butyl-2-(2-ethylpentylsulfanyl)phenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-(3-methoxypropyl)-1,2,4-benzothiadiazin-3-yl]acetamide.
| Compound Name | N-[5-tert-butyl-2-(2-ethylpentylsulfanyl)phenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-(3-methoxypropyl)-1,2,4-benzothiadiazin-3-yl]acetamide |
|---|---|
| PubChem CID | 156895179 |
| Molecular Formula | C35H48N4O5S2 |
| Molecular Weight | 668.93 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | N-[5-tert-butyl-2-(2-ethylpentylsulfanyl)phenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-(3-methoxypropyl)-1,2,4-benzothiadiazin-3-yl]acetamide |
| SMILES | CCCC(CC)CSc1ccc(C(C)(C)C)cc1NC(=O)C(C1=Nc2ccccc2SN1CCCOC)N1C(=O)OC(C)(C)C1=O |
| InChI | InChI=1S/C35H48N4O5S2/c1-9-14-23(10-2)22-45-27-18-17-24(34(3,4)5)21-26(27)37-31(40)29(39-32(41)35(6,7)44-33(39)42)30-36-25-15-11-12-16-28(25)46-38(30)19-13-20-43-8/h11-12,15-18,21,23,29H,9-10,13-14,19-20,22H2,1-8H3,(H,37,40) |
| InChIKey | OPUXYSCDTFPSTQ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.93 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|