C39H55N3O8 — CID 23525004
N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-methoxyphenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 23525004) has the molecular formula C39H55N3O8 and a molecular weight of 693.88 g/mol. Its IUPAC name is N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-methoxyphenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-methoxyphenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 23525004 |
| Molecular Formula | C39H55N3O8 |
| Molecular Weight | 693.88 g/mol |
| Exact Mass | 693.40 |
| IUPAC Name | N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-methoxyphenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(OC)c(NC(=O)C(C(=O)C(C)(C)C)N2C(=O)OC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C39H55N3O8/c1-14-27(49-28-19-17-23(37(7,8)15-2)21-25(28)38(9,10)16-3)32(44)40-24-18-20-29(48-13)26(22-24)41-33(45)30(31(43)36(4,5)6)42-34(46)39(11,12)50-35(42)47/h17-22,27,30H,14-16H2,1-13H3,(H,40,44)(H,41,45) |
| InChIKey | RMKWDQULDZZGPF-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.88 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|