C38H52ClN3O7 — CID 15065657
N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 15065657) has the molecular formula C38H52ClN3O7 and a molecular weight of 698.30 g/mol. Its IUPAC name is N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 15065657 |
| Molecular Formula | C38H52ClN3O7 |
| Molecular Weight | 698.30 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(=O)C(C(=O)C(C)(C)C)N2C(=O)OC(C)(C)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C38H52ClN3O7/c1-13-27(48-28-19-16-22(36(7,8)14-2)20-24(28)37(9,10)15-3)31(44)40-23-17-18-26(25(39)21-23)41-32(45)29(30(43)35(4,5)6)42-33(46)38(11,12)49-34(42)47/h16-21,27,29H,13-15H2,1-12H3,(H,40,44)(H,41,45) |
| InChIKey | JZVIUOTVBBCUSZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.30 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|