C33H45ClN2O4S2 — CID 139624753
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-chloro-3-[[3-(2-methyl-1,3-dithiolan-2-yl)-3-oxopropanoyl]amino]phenyl]butanamide (PubChem CID 139624753) has the molecular formula C33H45ClN2O4S2 and a molecular weight of 633.32 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-chloro-3-[[3-(2-methyl-1,3-dithiolan-2-yl)-3-oxopropanoyl]amino]phenyl]butanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-chloro-3-[[3-(2-methyl-1,3-dithiolan-2-yl)-3-oxopropanoyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 139624753 |
| Molecular Formula | C33H45ClN2O4S2 |
| Molecular Weight | 633.32 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-chloro-3-[[3-(2-methyl-1,3-dithiolan-2-yl)-3-oxopropanoyl]amino]phenyl]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(Cl)c(NC(=O)CC(=O)C2(C)SCCS2)c1 |
| InChI | InChI=1S/C33H45ClN2O4S2/c1-9-26(40-27-15-12-21(31(4,5)10-2)18-23(27)32(6,7)11-3)30(39)35-22-13-14-24(34)25(19-22)36-29(38)20-28(37)33(8)41-16-17-42-33/h12-15,18-19,26H,9-11,16-17,20H2,1-8H3,(H,35,39)(H,36,38) |
| InChIKey | HQHKLHYOMNQAAH-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.32 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|