C39H53ClN4O6 — CID 21447918
N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 21447918) has the molecular formula C39H53ClN4O6 and a molecular weight of 709.33 g/mol. Its IUPAC name is N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 21447918 |
| Molecular Formula | C39H53ClN4O6 |
| Molecular Weight | 709.33 g/mol |
| Exact Mass | 708.37 |
| IUPAC Name | N-[5-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(Cl)c(NC(=O)C(C(=O)C(C)(C)C)N2C(=O)C3CCCN3C2=O)c1 |
| InChI | InChI=1S/C39H53ClN4O6/c1-11-29(50-30-19-16-23(38(7,8)12-2)21-25(30)39(9,10)13-3)33(46)41-24-17-18-26(40)27(22-24)42-34(47)31(32(45)37(4,5)6)44-35(48)28-15-14-20-43(28)36(44)49/h16-19,21-22,28-29,31H,11-15,20H2,1-10H3,(H,41,46)(H,42,47) |
| InChIKey | UICGUPQZPYWUPN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.33 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|