C42H60ClN3O7 — CID 101318490
N-[2-chloro-5-[2-(2,4-dipentylphenoxy)butanoylamino]phenyl]-2-(2,4-dioxo-5,5-dipropyl-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 101318490) has the molecular formula C42H60ClN3O7 and a molecular weight of 754.41 g/mol. Its IUPAC name is N-[2-chloro-5-[2-(2,4-dipentylphenoxy)butanoylamino]phenyl]-2-(2,4-dioxo-5,5-dipropyl-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[2-chloro-5-[2-(2,4-dipentylphenoxy)butanoylamino]phenyl]-2-(2,4-dioxo-5,5-dipropyl-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 101318490 |
| Molecular Formula | C42H60ClN3O7 |
| Molecular Weight | 754.41 g/mol |
| Exact Mass | 753.41 |
| IUPAC Name | N-[2-chloro-5-[2-(2,4-dipentylphenoxy)butanoylamino]phenyl]-2-(2,4-dioxo-5,5-dipropyl-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCCCCc1ccc(OC(CC)C(=O)Nc2ccc(Cl)c(NC(=O)C(C(=O)C(C)(C)C)N3C(=O)OC(CCC)(CCC)C3=O)c2)c(CCCCC)c1 |
| InChI | InChI=1S/C42H60ClN3O7/c1-9-14-16-18-28-20-23-34(29(26-28)19-17-15-10-2)52-33(13-5)37(48)44-30-21-22-31(43)32(27-30)45-38(49)35(36(47)41(6,7)8)46-39(50)42(24-11-3,25-12-4)53-40(46)51/h20-23,26-27,33,35H,9-19,24-25H2,1-8H3,(H,44,48)(H,45,49) |
| InChIKey | FUELRDNWYCDMRC-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.41 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|