C25H31ClN2O4 — CID 54379502
N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 54379502) has the molecular formula C25H31ClN2O4 and a molecular weight of 458.99 g/mol. Its IUPAC name is N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 54379502 |
| Molecular Formula | C25H31ClN2O4 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)Nc1ccc(Cl)c(NC(=O)CC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H31ClN2O4/c1-7-20(32-21-11-8-15(2)12-16(21)3)24(31)27-17-9-10-18(26)19(13-17)28-23(30)14-22(29)25(4,5)6/h8-13,20H,7,14H2,1-6H3,(H,27,31)(H,28,30) |
| InChIKey | XYTAFYIREPUZJG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|