C34H40ClN3O5 — CID 21015263
N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-2-[4-(1-hydroxypentan-3-yl)-2-methylphenyl]imino-3-oxobutanamide (PubChem CID 21015263) has the molecular formula C34H40ClN3O5 and a molecular weight of 606.16 g/mol. Its IUPAC name is N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-2-[4-(1-hydroxypentan-3-yl)-2-methylphenyl]imino-3-oxobutanamide.
| Compound Name | N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-2-[4-(1-hydroxypentan-3-yl)-2-methylphenyl]imino-3-oxobutanamide |
|---|---|
| PubChem CID | 21015263 |
| Molecular Formula | C34H40ClN3O5 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | N-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]phenyl]-2-[4-(1-hydroxypentan-3-yl)-2-methylphenyl]imino-3-oxobutanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)Nc1ccc(Cl)c(NC(=O)/C(=N/c2ccc(C(CC)CCO)cc2C)C(C)=O)c1 |
| InChI | InChI=1S/C34H40ClN3O5/c1-7-24(15-16-39)25-10-13-28(21(4)18-25)37-32(23(6)40)34(42)38-29-19-26(11-12-27(29)35)36-33(41)30(8-2)43-31-14-9-20(3)17-22(31)5/h9-14,17-19,24,30,39H,7-8,15-16H2,1-6H3,(H,36,41)(H,38,42)/b37-32+ |
| InChIKey | HGBJRXRGUJONLX-BQNXFWFHSA-N |
| XLogP | 7.24 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|