C27H33ClN2O6 — CID 54333146
[1-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]anilino]-4,4-dimethyl-1,3-dioxopentan-2-yl] acetate (PubChem CID 54333146) has the molecular formula C27H33ClN2O6 and a molecular weight of 517.02 g/mol. Its IUPAC name is [1-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]anilino]-4,4-dimethyl-1,3-dioxopentan-2-yl] acetate.
| Compound Name | [1-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]anilino]-4,4-dimethyl-1,3-dioxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 54333146 |
| Molecular Formula | C27H33ClN2O6 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | [1-[2-chloro-5-[2-(2,4-dimethylphenoxy)butanoylamino]anilino]-4,4-dimethyl-1,3-dioxopentan-2-yl] acetate |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)Nc1ccc(Cl)c(NC(=O)C(OC(C)=O)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H33ClN2O6/c1-8-21(36-22-12-9-15(2)13-16(22)3)25(33)29-18-10-11-19(28)20(14-18)30-26(34)23(35-17(4)31)24(32)27(5,6)7/h9-14,21,23H,8H2,1-7H3,(H,29,33)(H,30,34) |
| InChIKey | CLKPEHLODOLEIM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|