C23H29N3O7 — CID 21350476
2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-methoxy-5-(2-methylprop-2-enoylamino)phenyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 21350476) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-methoxy-5-(2-methylprop-2-enoylamino)phenyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-methoxy-5-(2-methylprop-2-enoylamino)phenyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 21350476 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-[2-methoxy-5-(2-methylprop-2-enoylamino)phenyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | C=C(C)C(=O)Nc1ccc(OC)c(NC(=O)C(C(=O)C(C)(C)C)N2C(=O)OC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C23H29N3O7/c1-12(2)18(28)24-13-9-10-15(32-8)14(11-13)25-19(29)16(17(27)22(3,4)5)26-20(30)23(6,7)33-21(26)31/h9-11,16H,1H2,2-8H3,(H,24,28)(H,25,29) |
| InChIKey | SJMYSZXFFWPDRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|