C17H21N3O7S — CID 90922254
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)-3-oxobutanamide;sulfur dioxide (PubChem CID 90922254) has the molecular formula C17H21N3O7S and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)-3-oxobutanamide;sulfur dioxide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)-3-oxobutanamide;sulfur dioxide |
|---|---|
| PubChem CID | 90922254 |
| Molecular Formula | C17H21N3O7S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxy-5-methylphenyl)-3-oxobutanamide;sulfur dioxide |
| SMILES | COc1ccc(C)cc1NC(=O)C(C(C)=O)N1C(=O)NC(C)(C)C1=O.O=S=O |
| InChI | InChI=1S/C17H21N3O5.O2S/c1-9-6-7-12(25-5)11(8-9)18-14(22)13(10(2)21)20-15(23)17(3,4)19-16(20)24;1-3-2/h6-8,13H,1-5H3,(H,18,22)(H,19,24); |
| InChIKey | DBYRSGFRTDJOQD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|