C21H29N3O5 — CID 54465434
2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 54465434) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 54465434 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(CN1C(=O)NC(C)(C)C1=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H29N3O5/c1-12-8-9-15(29-7)14(10-12)22-17(26)13(16(25)20(2,3)4)11-24-18(27)21(5,6)23-19(24)28/h8-10,13H,11H2,1-7H3,(H,22,26)(H,23,28) |
| InChIKey | XEMOISMNWPLBCN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|