C19H22N2O4 — CID 7611381
(2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxy-5-methylphenyl)propanamide (PubChem CID 7611381) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxy-5-methylphenyl)propanamide.
| Compound Name | (2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 7611381 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-methoxy-5-methylphenyl)propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)N1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C19H22N2O4/c1-11-8-9-16(25-3)15(10-11)20-17(22)12(2)21-18(23)13-6-4-5-7-14(13)19(21)24/h4-5,8-10,12-14H,6-7H2,1-3H3,(H,20,22)/t12-,13+,14+/m0/s1 |
| InChIKey | QTXPFOSMQAAYTD-BFHYXJOUSA-N |
| XLogP | 2.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|