C20H25N3O6S — CID 98443174
(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]propanamide (PubChem CID 98443174) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]propanamide.
| Compound Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 98443174 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)N2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H25N3O6S/c1-12(23-19(25)14-7-5-6-8-15(14)20(23)26)18(24)21-13-9-10-16(29-4)17(11-13)30(27,28)22(2)3/h5-6,9-12,14-15H,7-8H2,1-4H3,(H,21,24)/t12-,14-,15+/m1/s1 |
| InChIKey | GGAVSKMLBBVNMF-YUELXQCFSA-N |
| XLogP | 1.22 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|