C25H24F2N2O5 — CID 24513090
(2S)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide (PubChem CID 24513090) has the molecular formula C25H24F2N2O5 and a molecular weight of 470.47 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 24513090 |
| Molecular Formula | C25H24F2N2O5 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (2S)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
| SMILES | COc1ccc(-c2cc(NC(=O)[C@H](C)N3C(=O)C4CC=CCC4C3=O)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C25H24F2N2O5/c1-14(29-23(31)18-5-3-4-6-19(18)24(29)32)22(30)28-16-9-12-21(34-25(26)27)20(13-16)15-7-10-17(33-2)11-8-15/h3-4,7-14,18-19,25H,5-6H2,1-2H3,(H,28,30)/t14-,18?,19?/m0/s1 |
| InChIKey | KZOLLDNCSQAWLH-YCMKEVRSSA-N |
| XLogP | 4.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|