C18H18ClN3O6 — CID 7470192
(2S)-2-[(3aR,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-methoxy-4-nitrophenyl)propanamide (PubChem CID 7470192) has the molecular formula C18H18ClN3O6 and a molecular weight of 407.81 g/mol. Its IUPAC name is (2S)-2-[(3aR,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-methoxy-4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(3aR,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-methoxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7470192 |
| Molecular Formula | C18H18ClN3O6 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (2S)-2-[(3aR,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-methoxy-4-nitrophenyl)propanamide |
| SMILES | COc1cc(NC(=O)[C@H](C)N2C(=O)[C@H]3CC=C(Cl)C[C@H]3C2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18ClN3O6/c1-9(21-17(24)12-5-3-10(19)7-13(12)18(21)25)16(23)20-11-4-6-14(22(26)27)15(8-11)28-2/h3-4,6,8-9,12-13H,5,7H2,1-2H3,(H,20,23)/t9-,12-,13+/m0/s1 |
| InChIKey | BCWBMOADFUDQBC-TVYUQYBPSA-N |
| XLogP | 2.45 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|