C17H15Cl3N2O3 — CID 7446574
(2R)-2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,4-dichlorophenyl)propanamide (PubChem CID 7446574) has the molecular formula C17H15Cl3N2O3 and a molecular weight of 401.68 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,4-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 7446574 |
| Molecular Formula | C17H15Cl3N2O3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | (2R)-2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,4-dichlorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Cl)c(Cl)c1)N1C(=O)[C@@H]2CC=C(Cl)C[C@H]2C1=O |
| InChI | InChI=1S/C17H15Cl3N2O3/c1-8(15(23)21-10-3-5-13(19)14(20)7-10)22-16(24)11-4-2-9(18)6-12(11)17(22)25/h2-3,5,7-8,11-12H,4,6H2,1H3,(H,21,23)/t8-,11-,12-/m1/s1 |
| InChIKey | DOJLHUMRZPZHPU-GGZOMVNGSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|