C20H22N2O5 — CID 98328262
methyl 2-[[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]amino]-6-methylbenzoate (PubChem CID 98328262) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]amino]-6-methylbenzoate.
| Compound Name | methyl 2-[[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]amino]-6-methylbenzoate |
|---|---|
| PubChem CID | 98328262 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 2-[[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]amino]-6-methylbenzoate |
| SMILES | COC(=O)c1c(C)cccc1NC(=O)[C@H](C)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C20H22N2O5/c1-11-7-6-10-15(16(11)20(26)27-3)21-17(23)12(2)22-18(24)13-8-4-5-9-14(13)19(22)25/h4-7,10,12-14H,8-9H2,1-3H3,(H,21,23)/t12-,13-,14+/m0/s1 |
| InChIKey | QIXLOBSYAGYSSQ-MELADBBJSA-N |
| XLogP | 2.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|