C35H40N4O7S2 — CID 58720585
N-(2-tert-butylsulfanylphenyl)-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide (PubChem CID 58720585) has the molecular formula C35H40N4O7S2 and a molecular weight of 692.86 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylphenyl)-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide.
| Compound Name | N-(2-tert-butylsulfanylphenyl)-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide |
|---|---|
| PubChem CID | 58720585 |
| Molecular Formula | C35H40N4O7S2 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | N-(2-tert-butylsulfanylphenyl)-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide |
| SMILES | Cc1ccc(OCCCN2C(C(C(=O)Nc3ccccc3SC(C)(C)C)N3C(=O)OC(C)(C)C3=O)=Nc3ccccc3S2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C35H40N4O7S2/c1-22-17-18-26(23(2)21-22)45-20-12-19-38-30(36-25-14-9-11-16-28(25)48(38,43)44)29(39-32(41)35(6,7)46-33(39)42)31(40)37-24-13-8-10-15-27(24)47-34(3,4)5/h8-11,13-18,21,29H,12,19-20H2,1-7H3,(H,37,40) |
| InChIKey | XWNOXWRLDJCXJF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|