C32H34ClN5O6S — CID 20722576
N-(5-chloro-2-methylphenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide (PubChem CID 20722576) has the molecular formula C32H34ClN5O6S and a molecular weight of 652.17 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide |
|---|---|
| PubChem CID | 20722576 |
| Molecular Formula | C32H34ClN5O6S |
| Molecular Weight | 652.17 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetamide |
| SMILES | Cc1ccc(OCCCN2C(C(C(=O)Nc3cc(Cl)ccc3C)N3C(=O)NC(C)(C)C3=O)=Nc3ccccc3S2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C32H34ClN5O6S/c1-19-11-14-25(21(3)17-19)44-16-8-15-37-28(34-23-9-6-7-10-26(23)45(37,42)43)27(38-30(40)32(4,5)36-31(38)41)29(39)35-24-18-22(33)13-12-20(24)2/h6-7,9-14,17-18,27H,8,15-16H2,1-5H3,(H,35,39)(H,36,41) |
| InChIKey | PXTIYADQJBKXRA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.17 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|