C32H32ClN5O6S — CID 20722315
2-[1-[2-(2-chloroanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethyl]-5-methylimidazol-4-yl]acetic acid (PubChem CID 20722315) has the molecular formula C32H32ClN5O6S and a molecular weight of 650.16 g/mol. Its IUPAC name is 2-[1-[2-(2-chloroanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethyl]-5-methylimidazol-4-yl]acetic acid.
| Compound Name | 2-[1-[2-(2-chloroanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethyl]-5-methylimidazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20722315 |
| Molecular Formula | C32H32ClN5O6S |
| Molecular Weight | 650.16 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 2-[1-[2-(2-chloroanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethyl]-5-methylimidazol-4-yl]acetic acid |
| SMILES | Cc1ccc(OCCCN2C(C(C(=O)Nc3ccccc3Cl)n3cnc(CC(=O)O)c3C)=Nc3ccccc3S2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C32H32ClN5O6S/c1-20-13-14-27(21(2)17-20)44-16-8-15-38-31(35-25-11-6-7-12-28(25)45(38,42)43)30(32(41)36-24-10-5-4-9-23(24)33)37-19-34-26(22(37)3)18-29(39)40/h4-7,9-14,17,19,30H,8,15-16,18H2,1-3H3,(H,36,41)(H,39,40) |
| InChIKey | FKFFRCLDUWSEMF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.16 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|