C31H31N7O8S — CID 20722306
1-[1-[2-[2-(2,4-dimethylphenoxy)butanoylamino]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid (PubChem CID 20722306) has the molecular formula C31H31N7O8S and a molecular weight of 661.70 g/mol. Its IUPAC name is 1-[1-[2-[2-(2,4-dimethylphenoxy)butanoylamino]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 1-[1-[2-[2-(2,4-dimethylphenoxy)butanoylamino]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 20722306 |
| Molecular Formula | C31H31N7O8S |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 1-[1-[2-[2-(2,4-dimethylphenoxy)butanoylamino]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)NN1C(C(C(=O)Nc2ccccc2OC)n2cnc(C(=O)O)n2)=Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C31H31N7O8S/c1-5-22(46-23-15-14-18(2)16-19(23)3)29(39)36-38-28(33-21-11-7-9-13-25(21)47(38,43)44)26(37-17-32-27(35-37)31(41)42)30(40)34-20-10-6-8-12-24(20)45-4/h6-17,22,26H,5H2,1-4H3,(H,34,40)(H,36,39)(H,41,42) |
| InChIKey | JAISKYMLCQPXFE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 194.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |