C33H35N5O9S — CID 20722410
3-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-yl]propanoic acid (PubChem CID 20722410) has the molecular formula C33H35N5O9S and a molecular weight of 677.74 g/mol. Its IUPAC name is 3-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 20722410 |
| Molecular Formula | C33H35N5O9S |
| Molecular Weight | 677.74 g/mol |
| Exact Mass | 677.22 |
| IUPAC Name | 3-[1-[1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| SMILES | COc1ccccc1NC(=O)C(C1=Nc2ccccc2S(=O)(=O)N1CCCOc1ccc(C)cc1C)N1C(=O)NC(CCC(=O)O)C1=O |
| InChI | InChI=1S/C33H35N5O9S/c1-20-13-15-25(21(2)19-20)47-18-8-17-37-30(34-23-10-5-7-12-27(23)48(37,44)45)29(31(41)35-22-9-4-6-11-26(22)46-3)38-32(42)24(36-33(38)43)14-16-28(39)40/h4-7,9-13,15,19,24,29H,8,14,16-18H2,1-3H3,(H,35,41)(H,36,43)(H,39,40) |
| InChIKey | CYDOSKXLKZPWKH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 184.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|