C36H38ClN5O9S2 — CID 58825278
6-[2-(4-chloro-2-methoxy-5-methylanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethoxy]-N-ethylsulfonylpyridine-3-carboxamide (PubChem CID 58825278) has the molecular formula C36H38ClN5O9S2 and a molecular weight of 784.31 g/mol. Its IUPAC name is 6-[2-(4-chloro-2-methoxy-5-methylanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethoxy]-N-ethylsulfonylpyridine-3-carboxamide.
| Compound Name | 6-[2-(4-chloro-2-methoxy-5-methylanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethoxy]-N-ethylsulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58825278 |
| Molecular Formula | C36H38ClN5O9S2 |
| Molecular Weight | 784.31 g/mol |
| Exact Mass | 783.18 |
| IUPAC Name | 6-[2-(4-chloro-2-methoxy-5-methylanilino)-1-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-oxoethoxy]-N-ethylsulfonylpyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)NC(=O)c1ccc(OC(C(=O)Nc2cc(C)c(Cl)cc2OC)C2=Nc3ccccc3S(=O)(=O)N2CCCOc2ccc(C)cc2C)nc1 |
| InChI | InChI=1S/C36H38ClN5O9S2/c1-6-52(45,46)41-35(43)25-13-15-32(38-21-25)51-33(36(44)40-28-19-23(3)26(37)20-30(28)49-5)34-39-27-10-7-8-11-31(27)53(47,48)42(34)16-9-17-50-29-14-12-22(2)18-24(29)4/h7-8,10-15,18-21,33H,6,9,16-17H2,1-5H3,(H,40,44)(H,41,43) |
| InChIKey | IWZIIQGFLURXJX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 182.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|