C40H50N4O8S — CID 23518208
2-[2-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-(2-methoxyphenyl)acetamide (PubChem CID 23518208) has the molecular formula C40H50N4O8S and a molecular weight of 746.93 g/mol. Its IUPAC name is 2-[2-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23518208 |
| Molecular Formula | C40H50N4O8S |
| Molecular Weight | 746.93 g/mol |
| Exact Mass | 746.33 |
| IUPAC Name | 2-[2-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-N-(2-methoxyphenyl)acetamide |
| SMILES | CCC(C)(C)c1ccc(OCCCN2C(C(C(=O)Nc3ccccc3OC)N3C(=O)OC(C)(C)C3=O)=Nc3ccccc3S2(=O)=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C40H50N4O8S/c1-10-38(3,4)26-21-22-30(27(25-26)39(5,6)11-2)51-24-16-23-43-34(41-29-18-13-15-20-32(29)53(43,48)49)33(44-36(46)40(7,8)52-37(44)47)35(45)42-28-17-12-14-19-31(28)50-9/h12-15,17-22,25,33H,10-11,16,23-24H2,1-9H3,(H,42,45) |
| InChIKey | XCPSPXXGEFTJCX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.93 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|